C23H17N9O6 — CID 6177337
2-N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-4-N-(4-nitrophenyl)-6-N-phenyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 6177337) has the molecular formula C23H17N9O6 and a molecular weight of 515.45 g/mol. Its IUPAC name is 2-N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-4-N-(4-nitrophenyl)-6-N-phenyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-4-N-(4-nitrophenyl)-6-N-phenyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 6177337 |
| Molecular Formula | C23H17N9O6 |
| Molecular Weight | 515.45 g/mol |
| Exact Mass | 515.13 |
| IUPAC Name | 2-N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-4-N-(4-nitrophenyl)-6-N-phenyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | O=[N+]([O-])c1ccc(Nc2nc(N/N=C\c3cc4c(cc3[N+](=O)[O-])OCO4)nc(Nc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C23H17N9O6/c33-31(34)17-8-6-16(7-9-17)26-22-27-21(25-15-4-2-1-3-5-15)28-23(29-22)30-24-12-14-10-19-20(38-13-37-19)11-18(14)32(35)36/h1-12H,13H2,(H3,25,26,27,28,29,30)/b24-12- |
| InChIKey | OWYVVCOHTAGOGW-MSXFZWOLSA-N |
| XLogP | 4.35 |
| TPSA | 191.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.45 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|