C22H18N2O3 — CID 7070939
(1S)-N-(2-nitrophenyl)-2,2-diphenylcyclopropane-1-carboxamide (PubChem CID 7070939) has the molecular formula C22H18N2O3 and a molecular weight of 358.40 g/mol. Its IUPAC name is (1S)-N-(2-nitrophenyl)-2,2-diphenylcyclopropane-1-carboxamide.
| Compound Name | (1S)-N-(2-nitrophenyl)-2,2-diphenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 7070939 |
| Molecular Formula | C22H18N2O3 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | (1S)-N-(2-nitrophenyl)-2,2-diphenylcyclopropane-1-carboxamide |
| SMILES | O=C(Nc1ccccc1[N+](=O)[O-])[C@H]1CC1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H18N2O3/c25-21(23-19-13-7-8-14-20(19)24(26)27)18-15-22(18,16-9-3-1-4-10-16)17-11-5-2-6-12-17/h1-14,18H,15H2,(H,23,25)/t18-/m1/s1 |
| InChIKey | ZEBJHFCREQHAHI-GOSISDBHSA-N |
| XLogP | 4.54 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|