C20H20N2O3 — CID 7375073
(1S,5S)-N-(2-nitrophenyl)-7-phenylbicyclo[3.1.1]heptane-6-carboxamide (PubChem CID 7375073) has the molecular formula C20H20N2O3 and a molecular weight of 336.39 g/mol. Its IUPAC name is (1S,5S)-N-(2-nitrophenyl)-7-phenylbicyclo[3.1.1]heptane-6-carboxamide.
| Compound Name | (1S,5S)-N-(2-nitrophenyl)-7-phenylbicyclo[3.1.1]heptane-6-carboxamide |
|---|---|
| PubChem CID | 7375073 |
| Molecular Formula | C20H20N2O3 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | (1S,5S)-N-(2-nitrophenyl)-7-phenylbicyclo[3.1.1]heptane-6-carboxamide |
| SMILES | O=C(Nc1ccccc1[N+](=O)[O-])C1[C@H]2CCC[C@H]1C2c1ccccc1 |
| InChI | InChI=1S/C20H20N2O3/c23-20(21-16-11-4-5-12-17(16)22(24)25)19-14-9-6-10-15(19)18(14)13-7-2-1-3-8-13/h1-5,7-8,11-12,14-15,18-19H,6,9-10H2,(H,21,23)/t14-,15-,18?,19?/m0/s1 |
| InChIKey | WCCLSRPUKLQPQP-GKVPXEHWSA-N |
| XLogP | 4.36 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|