C23H20N2O3 — CID 11911328
(1S,8S,9S,14S,15S)-N-(2-nitrophenyl)tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,10,12-pentaene-15-carboxamide (PubChem CID 11911328) has the molecular formula C23H20N2O3 and a molecular weight of 372.42 g/mol. Its IUPAC name is (1S,8S,9S,14S,15S)-N-(2-nitrophenyl)tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,10,12-pentaene-15-carboxamide.
| Compound Name | (1S,8S,9S,14S,15S)-N-(2-nitrophenyl)tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,10,12-pentaene-15-carboxamide |
|---|---|
| PubChem CID | 11911328 |
| Molecular Formula | C23H20N2O3 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | (1S,8S,9S,14S,15S)-N-(2-nitrophenyl)tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,10,12-pentaene-15-carboxamide |
| SMILES | O=C(Nc1ccccc1[N+](=O)[O-])[C@H]1C[C@@H]2c3ccccc3[C@H]1[C@H]1C=CC=C[C@@H]12 |
| InChI | InChI=1S/C23H20N2O3/c26-23(24-20-11-5-6-12-21(20)25(27)28)19-13-18-14-7-1-3-9-16(14)22(19)17-10-4-2-8-15(17)18/h1-12,14,16,18-19,22H,13H2,(H,24,26)/t14-,16-,18-,19-,22+/m0/s1 |
| InChIKey | KXQNDNYZTSBGGU-ZBMDRZHOSA-N |
| XLogP | 4.79 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|