C18H19N3O3 — CID 94080933
(2S)-2-(2-methylphenyl)-N-(2-nitrophenyl)pyrrolidine-1-carboxamide (PubChem CID 94080933) has the molecular formula C18H19N3O3 and a molecular weight of 325.37 g/mol. Its IUPAC name is (2S)-2-(2-methylphenyl)-N-(2-nitrophenyl)pyrrolidine-1-carboxamide.
| Compound Name | (2S)-2-(2-methylphenyl)-N-(2-nitrophenyl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 94080933 |
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | (2S)-2-(2-methylphenyl)-N-(2-nitrophenyl)pyrrolidine-1-carboxamide |
| SMILES | Cc1ccccc1[C@@H]1CCCN1C(=O)Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H19N3O3/c1-13-7-2-3-8-14(13)16-11-6-12-20(16)18(22)19-15-9-4-5-10-17(15)21(23)24/h2-5,7-10,16H,6,11-12H2,1H3,(H,19,22)/t16-/m0/s1 |
| InChIKey | CASFFELAOIRTQX-INIZCTEOSA-N |
| XLogP | 4.27 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|