C17H24N4O5 — CID 7441391
(2S)-2-N-(3-ethoxypropyl)-1-N-(2-nitrophenyl)pyrrolidine-1,2-dicarboxamide (PubChem CID 7441391) has the molecular formula C17H24N4O5 and a molecular weight of 364.40 g/mol. Its IUPAC name is (2S)-2-N-(3-ethoxypropyl)-1-N-(2-nitrophenyl)pyrrolidine-1,2-dicarboxamide.
| Compound Name | (2S)-2-N-(3-ethoxypropyl)-1-N-(2-nitrophenyl)pyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 7441391 |
| Molecular Formula | C17H24N4O5 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | (2S)-2-N-(3-ethoxypropyl)-1-N-(2-nitrophenyl)pyrrolidine-1,2-dicarboxamide |
| SMILES | CCOCCCNC(=O)[C@@H]1CCCN1C(=O)Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H24N4O5/c1-2-26-12-6-10-18-16(22)15-9-5-11-20(15)17(23)19-13-7-3-4-8-14(13)21(24)25/h3-4,7-8,15H,2,5-6,9-12H2,1H3,(H,18,22)(H,19,23)/t15-/m0/s1 |
| InChIKey | WIHJBNUHPNWHTO-HNNXBMFYSA-N |
| XLogP | 2.13 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|