C20H22N4O6 — CID 7441407
(2S)-2-N-(2,6-dimethoxyphenyl)-1-N-(2-nitrophenyl)pyrrolidine-1,2-dicarboxamide (PubChem CID 7441407) has the molecular formula C20H22N4O6 and a molecular weight of 414.42 g/mol. Its IUPAC name is (2S)-2-N-(2,6-dimethoxyphenyl)-1-N-(2-nitrophenyl)pyrrolidine-1,2-dicarboxamide.
| Compound Name | (2S)-2-N-(2,6-dimethoxyphenyl)-1-N-(2-nitrophenyl)pyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 7441407 |
| Molecular Formula | C20H22N4O6 |
| Molecular Weight | 414.42 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | (2S)-2-N-(2,6-dimethoxyphenyl)-1-N-(2-nitrophenyl)pyrrolidine-1,2-dicarboxamide |
| SMILES | COc1cccc(OC)c1NC(=O)[C@@H]1CCCN1C(=O)Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H22N4O6/c1-29-16-10-5-11-17(30-2)18(16)22-19(25)15-9-6-12-23(15)20(26)21-13-7-3-4-8-14(13)24(27)28/h3-5,7-8,10-11,15H,6,9,12H2,1-2H3,(H,21,26)(H,22,25)/t15-/m0/s1 |
| InChIKey | JZEOTEDHXMSHOY-HNNXBMFYSA-N |
| XLogP | 3.25 |
| TPSA | 123.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.42 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|