C19H27N3O3 — CID 1468739
(2S)-1-N-cyclohexyl-2-N-(2-methoxyphenyl)pyrrolidine-1,2-dicarboxamide (PubChem CID 1468739) has the molecular formula C19H27N3O3 and a molecular weight of 345.44 g/mol. Its IUPAC name is (2S)-1-N-cyclohexyl-2-N-(2-methoxyphenyl)pyrrolidine-1,2-dicarboxamide.
| Compound Name | (2S)-1-N-cyclohexyl-2-N-(2-methoxyphenyl)pyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 1468739 |
| Molecular Formula | C19H27N3O3 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | (2S)-1-N-cyclohexyl-2-N-(2-methoxyphenyl)pyrrolidine-1,2-dicarboxamide |
| SMILES | COc1ccccc1NC(=O)[C@@H]1CCCN1C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C19H27N3O3/c1-25-17-12-6-5-10-15(17)21-18(23)16-11-7-13-22(16)19(24)20-14-8-3-2-4-9-14/h5-6,10,12,14,16H,2-4,7-9,11,13H2,1H3,(H,20,24)(H,21,23)/t16-/m0/s1 |
| InChIKey | JUOWGXJHGXMOEO-INIZCTEOSA-N |
| XLogP | 3.14 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |