C19H20N2O4 — CID 800862
phenyl (2R)-2-[(2-methoxyphenyl)carbamoyl]pyrrolidine-1-carboxylate (PubChem CID 800862) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is phenyl (2R)-2-[(2-methoxyphenyl)carbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | phenyl (2R)-2-[(2-methoxyphenyl)carbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 800862 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | phenyl (2R)-2-[(2-methoxyphenyl)carbamoyl]pyrrolidine-1-carboxylate |
| SMILES | COc1ccccc1NC(=O)[C@H]1CCCN1C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C19H20N2O4/c1-24-17-12-6-5-10-15(17)20-18(22)16-11-7-13-21(16)19(23)25-14-8-3-2-4-9-14/h2-6,8-10,12,16H,7,11,13H2,1H3,(H,20,22)/t16-/m1/s1 |
| InChIKey | WSHOGFQHFFZMFA-MRXNPFEDSA-N |
| XLogP | 3.30 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |