C20H21BrN2O3 — CID 126003503
phenyl (2S)-2-[(2-bromo-4,5-dimethylphenyl)carbamoyl]pyrrolidine-1-carboxylate (PubChem CID 126003503) has the molecular formula C20H21BrN2O3 and a molecular weight of 417.30 g/mol. Its IUPAC name is phenyl (2S)-2-[(2-bromo-4,5-dimethylphenyl)carbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | phenyl (2S)-2-[(2-bromo-4,5-dimethylphenyl)carbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 126003503 |
| Molecular Formula | C20H21BrN2O3 |
| Molecular Weight | 417.30 g/mol |
| Exact Mass | 416.07 |
| IUPAC Name | phenyl (2S)-2-[(2-bromo-4,5-dimethylphenyl)carbamoyl]pyrrolidine-1-carboxylate |
| SMILES | Cc1cc(Br)c(NC(=O)[C@@H]2CCCN2C(=O)Oc2ccccc2)cc1C |
| InChI | InChI=1S/C20H21BrN2O3/c1-13-11-16(21)17(12-14(13)2)22-19(24)18-9-6-10-23(18)20(25)26-15-7-4-3-5-8-15/h3-5,7-8,11-12,18H,6,9-10H2,1-2H3,(H,22,24)/t18-/m0/s1 |
| InChIKey | BGSJKPHSXVMNDP-SFHVURJKSA-N |
| XLogP | 4.67 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.30 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |