C19H20N2O3 — CID 655757
phenyl 2-[(4-methylphenyl)carbamoyl]pyrrolidine-1-carboxylate (PubChem CID 655757) has the molecular formula C19H20N2O3 and a molecular weight of 324.38 g/mol. Its IUPAC name is phenyl 2-[(4-methylphenyl)carbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | phenyl 2-[(4-methylphenyl)carbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 655757 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | phenyl 2-[(4-methylphenyl)carbamoyl]pyrrolidine-1-carboxylate |
| SMILES | Cc1ccc(NC(=O)C2CCCN2C(=O)Oc2ccccc2)cc1 |
| InChI | InChI=1S/C19H20N2O3/c1-14-9-11-15(12-10-14)20-18(22)17-8-5-13-21(17)19(23)24-16-6-3-2-4-7-16/h2-4,6-7,9-12,17H,5,8,13H2,1H3,(H,20,22) |
| InChIKey | UBPGAGHLBNQINO-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |