C18H24N2O3 — CID 3112487
phenyl 2-(cyclohexylcarbamoyl)pyrrolidine-1-carboxylate (PubChem CID 3112487) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is phenyl 2-(cyclohexylcarbamoyl)pyrrolidine-1-carboxylate.
| Compound Name | phenyl 2-(cyclohexylcarbamoyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 3112487 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | phenyl 2-(cyclohexylcarbamoyl)pyrrolidine-1-carboxylate |
| SMILES | O=C(NC1CCCCC1)C1CCCN1C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C18H24N2O3/c21-17(19-14-8-3-1-4-9-14)16-12-7-13-20(16)18(22)23-15-10-5-2-6-11-15/h2,5-6,10-11,14,16H,1,3-4,7-9,12-13H2,(H,19,21) |
| InChIKey | VUNGPIBABRURPY-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |