C18H25N3O3 — CID 1433458
(2S)-2-N-cyclopentyl-1-N-(3-methoxyphenyl)pyrrolidine-1,2-dicarboxamide (PubChem CID 1433458) has the molecular formula C18H25N3O3 and a molecular weight of 331.42 g/mol. Its IUPAC name is (2S)-2-N-cyclopentyl-1-N-(3-methoxyphenyl)pyrrolidine-1,2-dicarboxamide.
| Compound Name | (2S)-2-N-cyclopentyl-1-N-(3-methoxyphenyl)pyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 1433458 |
| Molecular Formula | C18H25N3O3 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | (2S)-2-N-cyclopentyl-1-N-(3-methoxyphenyl)pyrrolidine-1,2-dicarboxamide |
| SMILES | COc1cccc(NC(=O)N2CCC[C@H]2C(=O)NC2CCCC2)c1 |
| InChI | InChI=1S/C18H25N3O3/c1-24-15-9-4-8-14(12-15)20-18(23)21-11-5-10-16(21)17(22)19-13-6-2-3-7-13/h4,8-9,12-13,16H,2-3,5-7,10-11H2,1H3,(H,19,22)(H,20,23)/t16-/m0/s1 |
| InChIKey | MTSXFNARUNHAPB-INIZCTEOSA-N |
| XLogP | 2.75 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |