C17H22FN3O2 — CID 1443076
(2R)-2-N-cyclopentyl-1-N-(3-fluorophenyl)pyrrolidine-1,2-dicarboxamide (PubChem CID 1443076) has the molecular formula C17H22FN3O2 and a molecular weight of 319.38 g/mol. Its IUPAC name is (2R)-2-N-cyclopentyl-1-N-(3-fluorophenyl)pyrrolidine-1,2-dicarboxamide.
| Compound Name | (2R)-2-N-cyclopentyl-1-N-(3-fluorophenyl)pyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 1443076 |
| Molecular Formula | C17H22FN3O2 |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | (2R)-2-N-cyclopentyl-1-N-(3-fluorophenyl)pyrrolidine-1,2-dicarboxamide |
| SMILES | O=C(NC1CCCC1)[C@H]1CCCN1C(=O)Nc1cccc(F)c1 |
| InChI | InChI=1S/C17H22FN3O2/c18-12-5-3-8-14(11-12)20-17(23)21-10-4-9-15(21)16(22)19-13-6-1-2-7-13/h3,5,8,11,13,15H,1-2,4,6-7,9-10H2,(H,19,22)(H,20,23)/t15-/m1/s1 |
| InChIKey | BPZKMEHHBZDTRK-OAHLLOKOSA-N |
| XLogP | 2.88 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |