C15H18N4O4 — CID 78877015
2-N-cyclopropyl-1-N-(3-nitrophenyl)pyrrolidine-1,2-dicarboxamide (PubChem CID 78877015) has the molecular formula C15H18N4O4 and a molecular weight of 318.33 g/mol. Its IUPAC name is 2-N-cyclopropyl-1-N-(3-nitrophenyl)pyrrolidine-1,2-dicarboxamide.
| Compound Name | 2-N-cyclopropyl-1-N-(3-nitrophenyl)pyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 78877015 |
| Molecular Formula | C15H18N4O4 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | 2-N-cyclopropyl-1-N-(3-nitrophenyl)pyrrolidine-1,2-dicarboxamide |
| SMILES | O=C(NC1CC1)C1CCCN1C(=O)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H18N4O4/c20-14(16-10-6-7-10)13-5-2-8-18(13)15(21)17-11-3-1-4-12(9-11)19(22)23/h1,3-4,9-10,13H,2,5-8H2,(H,16,20)(H,17,21) |
| InChIKey | RKLVLJCZNUUVOP-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 104.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|