C15H19N5O5 — CID 95149524
(2S)-N-methyl-1-[2-[(3-nitrophenyl)carbamoylamino]acetyl]pyrrolidine-2-carboxamide (PubChem CID 95149524) has the molecular formula C15H19N5O5 and a molecular weight of 349.35 g/mol. Its IUPAC name is (2S)-N-methyl-1-[2-[(3-nitrophenyl)carbamoylamino]acetyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-methyl-1-[2-[(3-nitrophenyl)carbamoylamino]acetyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 95149524 |
| Molecular Formula | C15H19N5O5 |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | (2S)-N-methyl-1-[2-[(3-nitrophenyl)carbamoylamino]acetyl]pyrrolidine-2-carboxamide |
| SMILES | CNC(=O)[C@@H]1CCCN1C(=O)CNC(=O)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H19N5O5/c1-16-14(22)12-6-3-7-19(12)13(21)9-17-15(23)18-10-4-2-5-11(8-10)20(24)25/h2,4-5,8,12H,3,6-7,9H2,1H3,(H,16,22)(H2,17,18,23)/t12-/m0/s1 |
| InChIKey | NMNNZPLXFMAHRR-LBPRGKRZSA-N |
| XLogP | 0.45 |
| TPSA | 133.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|