C15H19ClN4O3 — CID 95330581
(2R)-1-[2-[(4-chlorophenyl)carbamoylamino]acetyl]-N-methylpyrrolidine-2-carboxamide (PubChem CID 95330581) has the molecular formula C15H19ClN4O3 and a molecular weight of 338.80 g/mol. Its IUPAC name is (2R)-1-[2-[(4-chlorophenyl)carbamoylamino]acetyl]-N-methylpyrrolidine-2-carboxamide.
| Compound Name | (2R)-1-[2-[(4-chlorophenyl)carbamoylamino]acetyl]-N-methylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 95330581 |
| Molecular Formula | C15H19ClN4O3 |
| Molecular Weight | 338.80 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | (2R)-1-[2-[(4-chlorophenyl)carbamoylamino]acetyl]-N-methylpyrrolidine-2-carboxamide |
| SMILES | CNC(=O)[C@H]1CCCN1C(=O)CNC(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H19ClN4O3/c1-17-14(22)12-3-2-8-20(12)13(21)9-18-15(23)19-11-6-4-10(16)5-7-11/h4-7,12H,2-3,8-9H2,1H3,(H,17,22)(H2,18,19,23)/t12-/m1/s1 |
| InChIKey | YKQSICGOHSTOLU-GFCCVEGCSA-N |
| XLogP | 1.20 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.80 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |