C14H18ClN3O3S — CID 119051827
1-[2-[[2-(5-chlorothiophen-2-yl)acetyl]amino]acetyl]-N-methylpyrrolidine-2-carboxamide (PubChem CID 119051827) has the molecular formula C14H18ClN3O3S and a molecular weight of 343.84 g/mol. Its IUPAC name is 1-[2-[[2-(5-chlorothiophen-2-yl)acetyl]amino]acetyl]-N-methylpyrrolidine-2-carboxamide.
| Compound Name | 1-[2-[[2-(5-chlorothiophen-2-yl)acetyl]amino]acetyl]-N-methylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 119051827 |
| Molecular Formula | C14H18ClN3O3S |
| Molecular Weight | 343.84 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | 1-[2-[[2-(5-chlorothiophen-2-yl)acetyl]amino]acetyl]-N-methylpyrrolidine-2-carboxamide |
| SMILES | CNC(=O)C1CCCN1C(=O)CNC(=O)Cc1ccc(Cl)s1 |
| InChI | InChI=1S/C14H18ClN3O3S/c1-16-14(21)10-3-2-6-18(10)13(20)8-17-12(19)7-9-4-5-11(15)22-9/h4-5,10H,2-3,6-8H2,1H3,(H,16,21)(H,17,19) |
| InChIKey | VXGWZCQECMCVLW-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.84 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |