C23H24N4O4 — CID 56533854
N-methyl-1-[2-[[2-(9-oxoacridin-10-yl)acetyl]amino]acetyl]pyrrolidine-2-carboxamide (PubChem CID 56533854) has the molecular formula C23H24N4O4 and a molecular weight of 420.47 g/mol. Its IUPAC name is N-methyl-1-[2-[[2-(9-oxoacridin-10-yl)acetyl]amino]acetyl]pyrrolidine-2-carboxamide.
| Compound Name | N-methyl-1-[2-[[2-(9-oxoacridin-10-yl)acetyl]amino]acetyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 56533854 |
| Molecular Formula | C23H24N4O4 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | N-methyl-1-[2-[[2-(9-oxoacridin-10-yl)acetyl]amino]acetyl]pyrrolidine-2-carboxamide |
| SMILES | CNC(=O)C1CCCN1C(=O)CNC(=O)Cn1c2ccccc2c(=O)c2ccccc21 |
| InChI | InChI=1S/C23H24N4O4/c1-24-23(31)19-11-6-12-26(19)21(29)13-25-20(28)14-27-17-9-4-2-7-15(17)22(30)16-8-3-5-10-18(16)27/h2-5,7-10,19H,6,11-14H2,1H3,(H,24,31)(H,25,28) |
| InChIKey | NINNNMXTFBQAKN-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 100.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|