C20H18N2O4 — CID 119355662
1-[2-(9-oxoacridin-10-yl)acetyl]pyrrolidine-2-carboxylic acid (PubChem CID 119355662) has the molecular formula C20H18N2O4 and a molecular weight of 350.37 g/mol. Its IUPAC name is 1-[2-(9-oxoacridin-10-yl)acetyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[2-(9-oxoacridin-10-yl)acetyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 119355662 |
| Molecular Formula | C20H18N2O4 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 1-[2-(9-oxoacridin-10-yl)acetyl]pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)C1CCCN1C(=O)Cn1c2ccccc2c(=O)c2ccccc21 |
| InChI | InChI=1S/C20H18N2O4/c23-18(21-11-5-10-17(21)20(25)26)12-22-15-8-3-1-6-13(15)19(24)14-7-2-4-9-16(14)22/h1-4,6-9,17H,5,10-12H2,(H,25,26) |
| InChIKey | QHTHDSPWCILTRU-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 79.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|