C17H21N3O5 — CID 95273963
methyl 4-[[2-[(2S)-2-(methylcarbamoyl)pyrrolidin-1-yl]-2-oxoethyl]carbamoyl]benzoate (PubChem CID 95273963) has the molecular formula C17H21N3O5 and a molecular weight of 347.37 g/mol. Its IUPAC name is methyl 4-[[2-[(2S)-2-(methylcarbamoyl)pyrrolidin-1-yl]-2-oxoethyl]carbamoyl]benzoate.
| Compound Name | methyl 4-[[2-[(2S)-2-(methylcarbamoyl)pyrrolidin-1-yl]-2-oxoethyl]carbamoyl]benzoate |
|---|---|
| PubChem CID | 95273963 |
| Molecular Formula | C17H21N3O5 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | methyl 4-[[2-[(2S)-2-(methylcarbamoyl)pyrrolidin-1-yl]-2-oxoethyl]carbamoyl]benzoate |
| SMILES | CNC(=O)[C@@H]1CCCN1C(=O)CNC(=O)c1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C17H21N3O5/c1-18-16(23)13-4-3-9-20(13)14(21)10-19-15(22)11-5-7-12(8-6-11)17(24)25-2/h5-8,13H,3-4,9-10H2,1-2H3,(H,18,23)(H,19,22)/t13-/m0/s1 |
| InChIKey | CVCKWVVNCPQWSK-ZDUSSCGKSA-N |
| XLogP | -0.06 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |