C8H14N2O3 — CID 115606581
methyl 2-(methylcarbamoyl)pyrrolidine-1-carboxylate (PubChem CID 115606581) has the molecular formula C8H14N2O3 and a molecular weight of 186.21 g/mol. Its IUPAC name is methyl 2-(methylcarbamoyl)pyrrolidine-1-carboxylate.
| Compound Name | methyl 2-(methylcarbamoyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 115606581 |
| Molecular Formula | C8H14N2O3 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | methyl 2-(methylcarbamoyl)pyrrolidine-1-carboxylate |
| SMILES | CNC(=O)C1CCCN1C(=O)OC |
| InChI | InChI=1S/C8H14N2O3/c1-9-7(11)6-4-3-5-10(6)8(12)13-2/h6H,3-5H2,1-2H3,(H,9,11) |
| InChIKey | PJLLRIOYJARYLK-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |