C10H18N2O3 — CID 116654854
propan-2-yl 2-(methylcarbamoyl)pyrrolidine-1-carboxylate (PubChem CID 116654854) has the molecular formula C10H18N2O3 and a molecular weight of 214.26 g/mol. Its IUPAC name is propan-2-yl 2-(methylcarbamoyl)pyrrolidine-1-carboxylate.
| Compound Name | propan-2-yl 2-(methylcarbamoyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 116654854 |
| Molecular Formula | C10H18N2O3 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.13 |
| IUPAC Name | propan-2-yl 2-(methylcarbamoyl)pyrrolidine-1-carboxylate |
| SMILES | CNC(=O)C1CCCN1C(=O)OC(C)C |
| InChI | InChI=1S/C10H18N2O3/c1-7(2)15-10(14)12-6-4-5-8(12)9(13)11-3/h7-8H,4-6H2,1-3H3,(H,11,13) |
| InChIKey | FPVVCYKHBXCLDZ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |