C16H30N2O4 — CID 58048617
propan-2-yl (2S)-2-[(2-methyl-1-propoxypropyl)carbamoyl]pyrrolidine-1-carboxylate (PubChem CID 58048617) has the molecular formula C16H30N2O4 and a molecular weight of 314.43 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[(2-methyl-1-propoxypropyl)carbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | propan-2-yl (2S)-2-[(2-methyl-1-propoxypropyl)carbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 58048617 |
| Molecular Formula | C16H30N2O4 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | propan-2-yl (2S)-2-[(2-methyl-1-propoxypropyl)carbamoyl]pyrrolidine-1-carboxylate |
| SMILES | CCCOC(NC(=O)[C@@H]1CCCN1C(=O)OC(C)C)C(C)C |
| InChI | InChI=1S/C16H30N2O4/c1-6-10-21-15(11(2)3)17-14(19)13-8-7-9-18(13)16(20)22-12(4)5/h11-13,15H,6-10H2,1-5H3,(H,17,19)/t13-,15?/m0/s1 |
| InChIKey | GOJRNBIUDXXUGP-CFMCSPIPSA-N |
| XLogP | 2.52 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|