C17H27N3O6 — CID 143350762
propan-2-yl N-[2-[(2S)-2-(1,2-dioxohexan-3-ylcarbamoyl)pyrrolidin-1-yl]-2-oxoethyl]carbamate (PubChem CID 143350762) has the molecular formula C17H27N3O6 and a molecular weight of 369.42 g/mol. Its IUPAC name is propan-2-yl N-[2-[(2S)-2-(1,2-dioxohexan-3-ylcarbamoyl)pyrrolidin-1-yl]-2-oxoethyl]carbamate.
| Compound Name | propan-2-yl N-[2-[(2S)-2-(1,2-dioxohexan-3-ylcarbamoyl)pyrrolidin-1-yl]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 143350762 |
| Molecular Formula | C17H27N3O6 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | propan-2-yl N-[2-[(2S)-2-(1,2-dioxohexan-3-ylcarbamoyl)pyrrolidin-1-yl]-2-oxoethyl]carbamate |
| SMILES | CCCC(NC(=O)[C@@H]1CCCN1C(=O)CNC(=O)OC(C)C)C(=O)C=O |
| InChI | InChI=1S/C17H27N3O6/c1-4-6-12(14(22)10-21)19-16(24)13-7-5-8-20(13)15(23)9-18-17(25)26-11(2)3/h10-13H,4-9H2,1-3H3,(H,18,25)(H,19,24)/t12?,13-/m0/s1 |
| InChIKey | MWHUSRUICAJINM-ABLWVSNPSA-N |
| XLogP | 0.16 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|