C16H27N3O6 — CID 142945754
(2S)-2-[[(2S)-1-[2-(butylamino)acetyl]pyrrolidine-2-carbonyl]amino]pentanedioic acid (PubChem CID 142945754) has the molecular formula C16H27N3O6 and a molecular weight of 357.41 g/mol. Its IUPAC name is (2S)-2-[[(2S)-1-[2-(butylamino)acetyl]pyrrolidine-2-carbonyl]amino]pentanedioic acid.
| Compound Name | (2S)-2-[[(2S)-1-[2-(butylamino)acetyl]pyrrolidine-2-carbonyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 142945754 |
| Molecular Formula | C16H27N3O6 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | (2S)-2-[[(2S)-1-[2-(butylamino)acetyl]pyrrolidine-2-carbonyl]amino]pentanedioic acid |
| SMILES | CCCCNCC(=O)N1CCC[C@H]1C(=O)N[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C16H27N3O6/c1-2-3-8-17-10-13(20)19-9-4-5-12(19)15(23)18-11(16(24)25)6-7-14(21)22/h11-12,17H,2-10H2,1H3,(H,18,23)(H,21,22)(H,24,25)/t11-,12-/m0/s1 |
| InChIKey | CPIDAYZZGJVHTH-RYUDHWBXSA-N |
| XLogP | -0.20 |
| TPSA | 136.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|