C16H27N3O6 — CID 67061894
(2S)-2-[[(2S)-1-(2-aminoacetyl)pyrrolidine-2-carbonyl]amino]-4-butylpentanedioic acid (PubChem CID 67061894) has the molecular formula C16H27N3O6 and a molecular weight of 357.41 g/mol. Its IUPAC name is (2S)-2-[[(2S)-1-(2-aminoacetyl)pyrrolidine-2-carbonyl]amino]-4-butylpentanedioic acid.
| Compound Name | (2S)-2-[[(2S)-1-(2-aminoacetyl)pyrrolidine-2-carbonyl]amino]-4-butylpentanedioic acid |
|---|---|
| PubChem CID | 67061894 |
| Molecular Formula | C16H27N3O6 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | (2S)-2-[[(2S)-1-(2-aminoacetyl)pyrrolidine-2-carbonyl]amino]-4-butylpentanedioic acid |
| SMILES | CCCCC(C[C@H](NC(=O)[C@@H]1CCCN1C(=O)CN)C(=O)O)C(=O)O |
| InChI | InChI=1S/C16H27N3O6/c1-2-3-5-10(15(22)23)8-11(16(24)25)18-14(21)12-6-4-7-19(12)13(20)9-17/h10-12H,2-9,17H2,1H3,(H,18,21)(H,22,23)(H,24,25)/t10?,11-,12-/m0/s1 |
| InChIKey | IKZWTHQHRZZHHR-RAMGSTBQSA-N |
| XLogP | -0.21 |
| TPSA | 150.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |