C14H23N3O4 — CID 143815717
ethyl 2-[[1-(2-aminoacetyl)pyrrolidine-2-carbonyl]amino]pent-4-enoate (PubChem CID 143815717) has the molecular formula C14H23N3O4 and a molecular weight of 297.36 g/mol. Its IUPAC name is ethyl 2-[[1-(2-aminoacetyl)pyrrolidine-2-carbonyl]amino]pent-4-enoate.
| Compound Name | ethyl 2-[[1-(2-aminoacetyl)pyrrolidine-2-carbonyl]amino]pent-4-enoate |
|---|---|
| PubChem CID | 143815717 |
| Molecular Formula | C14H23N3O4 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | ethyl 2-[[1-(2-aminoacetyl)pyrrolidine-2-carbonyl]amino]pent-4-enoate |
| SMILES | C=CCC(NC(=O)C1CCCN1C(=O)CN)C(=O)OCC |
| InChI | InChI=1S/C14H23N3O4/c1-3-6-10(14(20)21-4-2)16-13(19)11-7-5-8-17(11)12(18)9-15/h3,10-11H,1,4-9,15H2,2H3,(H,16,19) |
| InChIKey | LKWXZHZCXFQOMT-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|