C18H28N4O5 — CID 123961886
cyclopentyl N-[2-[2-[(1-amino-1-oxopent-4-en-2-yl)carbamoyl]pyrrolidin-1-yl]-2-oxoethyl]carbamate (PubChem CID 123961886) has the molecular formula C18H28N4O5 and a molecular weight of 380.45 g/mol. Its IUPAC name is cyclopentyl N-[2-[2-[(1-amino-1-oxopent-4-en-2-yl)carbamoyl]pyrrolidin-1-yl]-2-oxoethyl]carbamate.
| Compound Name | cyclopentyl N-[2-[2-[(1-amino-1-oxopent-4-en-2-yl)carbamoyl]pyrrolidin-1-yl]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 123961886 |
| Molecular Formula | C18H28N4O5 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | cyclopentyl N-[2-[2-[(1-amino-1-oxopent-4-en-2-yl)carbamoyl]pyrrolidin-1-yl]-2-oxoethyl]carbamate |
| SMILES | C=CCC(NC(=O)C1CCCN1C(=O)CNC(=O)OC1CCCC1)C(N)=O |
| InChI | InChI=1S/C18H28N4O5/c1-2-6-13(16(19)24)21-17(25)14-9-5-10-22(14)15(23)11-20-18(26)27-12-7-3-4-8-12/h2,12-14H,1,3-11H2,(H2,19,24)(H,20,26)(H,21,25) |
| InChIKey | CYTKUKKNOHRERF-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|