C25H39N3O6 — CID 143018650
methyl (Z)-2-[[1-[2-(cyclopentyloxycarbonylamino)acetyl]pyrrolidine-2-carbonyl]amino]-3-methylidenedec-4-enoate (PubChem CID 143018650) has the molecular formula C25H39N3O6 and a molecular weight of 477.60 g/mol. Its IUPAC name is methyl (Z)-2-[[1-[2-(cyclopentyloxycarbonylamino)acetyl]pyrrolidine-2-carbonyl]amino]-3-methylidenedec-4-enoate.
| Compound Name | methyl (Z)-2-[[1-[2-(cyclopentyloxycarbonylamino)acetyl]pyrrolidine-2-carbonyl]amino]-3-methylidenedec-4-enoate |
|---|---|
| PubChem CID | 143018650 |
| Molecular Formula | C25H39N3O6 |
| Molecular Weight | 477.60 g/mol |
| Exact Mass | 477.28 |
| IUPAC Name | methyl (Z)-2-[[1-[2-(cyclopentyloxycarbonylamino)acetyl]pyrrolidine-2-carbonyl]amino]-3-methylidenedec-4-enoate |
| SMILES | C=C(/C=C\CCCCC)C(NC(=O)C1CCCN1C(=O)CNC(=O)OC1CCCC1)C(=O)OC |
| InChI | InChI=1S/C25H39N3O6/c1-4-5-6-7-8-12-18(2)22(24(31)33-3)27-23(30)20-15-11-16-28(20)21(29)17-26-25(32)34-19-13-9-10-14-19/h8,12,19-20,22H,2,4-7,9-11,13-17H2,1,3H3,(H,26,32)(H,27,30)/b12-8- |
| InChIKey | GUEYLQPAIAELBQ-WQLSENKSSA-N |
| XLogP | 3.00 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.60 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|