C19H32N2O6 — CID 143680726
tert-butyl (2S)-2-[(1-ethoxy-3-methyl-1-oxopent-4-en-2-yl)carbamoyl]pyrrolidine-1-carboxylate;formaldehyde (PubChem CID 143680726) has the molecular formula C19H32N2O6 and a molecular weight of 384.47 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(1-ethoxy-3-methyl-1-oxopent-4-en-2-yl)carbamoyl]pyrrolidine-1-carboxylate;formaldehyde.
| Compound Name | tert-butyl (2S)-2-[(1-ethoxy-3-methyl-1-oxopent-4-en-2-yl)carbamoyl]pyrrolidine-1-carboxylate;formaldehyde |
|---|---|
| PubChem CID | 143680726 |
| Molecular Formula | C19H32N2O6 |
| Molecular Weight | 384.47 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | tert-butyl (2S)-2-[(1-ethoxy-3-methyl-1-oxopent-4-en-2-yl)carbamoyl]pyrrolidine-1-carboxylate;formaldehyde |
| SMILES | C=CC(C)C(NC(=O)[C@@H]1CCCN1C(=O)OC(C)(C)C)C(=O)OCC.C=O |
| InChI | InChI=1S/C18H30N2O5.CH2O/c1-7-12(3)14(16(22)24-8-2)19-15(21)13-10-9-11-20(13)17(23)25-18(4,5)6;1-2/h7,12-14H,1,8-11H2,2-6H3,(H,19,21);1H2/t12?,13-,14?;/m0./s1 |
| InChIKey | XVIQCNJJONSXOE-GGGYYQAESA-N |
| XLogP | 2.07 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.47 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|