C15H28N2O3 — CID 70050480
tert-butyl (2R)-2-(3-methylbutylcarbamoyl)pyrrolidine-1-carboxylate (PubChem CID 70050480) has the molecular formula C15H28N2O3 and a molecular weight of 284.40 g/mol. Its IUPAC name is tert-butyl (2R)-2-(3-methylbutylcarbamoyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-(3-methylbutylcarbamoyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 70050480 |
| Molecular Formula | C15H28N2O3 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.21 |
| IUPAC Name | tert-butyl (2R)-2-(3-methylbutylcarbamoyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)CCNC(=O)[C@H]1CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H28N2O3/c1-11(2)8-9-16-13(18)12-7-6-10-17(12)14(19)20-15(3,4)5/h11-12H,6-10H2,1-5H3,(H,16,18)/t12-/m1/s1 |
| InChIKey | BBNDXKRYDVONPA-GFCCVEGCSA-N |
| XLogP | 2.55 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |