C17H31N3O5 — CID 11057426
tert-butyl (2S)-2-[[(5S)-5-amino-6-methoxy-6-oxohexyl]carbamoyl]pyrrolidine-1-carboxylate (PubChem CID 11057426) has the molecular formula C17H31N3O5 and a molecular weight of 357.45 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[(5S)-5-amino-6-methoxy-6-oxohexyl]carbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[[(5S)-5-amino-6-methoxy-6-oxohexyl]carbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 11057426 |
| Molecular Formula | C17H31N3O5 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | tert-butyl (2S)-2-[[(5S)-5-amino-6-methoxy-6-oxohexyl]carbamoyl]pyrrolidine-1-carboxylate |
| SMILES | COC(=O)[C@@H](N)CCCCNC(=O)[C@@H]1CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H31N3O5/c1-17(2,3)25-16(23)20-11-7-9-13(20)14(21)19-10-6-5-8-12(18)15(22)24-4/h12-13H,5-11,18H2,1-4H3,(H,19,21)/t12-,13-/m0/s1 |
| InChIKey | UPRZSTPQAZZJQN-STQMWFEESA-N |
| XLogP | 1.17 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|