C18H32N2O6Si — CID 134830765
tert-butyl 2-[3-(3,5-dimethyl-2,6,7-trioxa-1-silabicyclo[2.2.1]heptan-1-yl)propylcarbamoyl]pyrrolidine-1-carboxylate (PubChem CID 134830765) has the molecular formula C18H32N2O6Si and a molecular weight of 400.55 g/mol. Its IUPAC name is tert-butyl 2-[3-(3,5-dimethyl-2,6,7-trioxa-1-silabicyclo[2.2.1]heptan-1-yl)propylcarbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[3-(3,5-dimethyl-2,6,7-trioxa-1-silabicyclo[2.2.1]heptan-1-yl)propylcarbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 134830765 |
| Molecular Formula | C18H32N2O6Si |
| Molecular Weight | 400.55 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | tert-butyl 2-[3-(3,5-dimethyl-2,6,7-trioxa-1-silabicyclo[2.2.1]heptan-1-yl)propylcarbamoyl]pyrrolidine-1-carboxylate |
| SMILES | CC1O[Si]2(CCCNC(=O)C3CCCN3C(=O)OC(C)(C)C)OC(C)C1O2 |
| InChI | InChI=1S/C18H32N2O6Si/c1-12-15-13(2)25-27(24-12,26-15)11-7-9-19-16(21)14-8-6-10-20(14)17(22)23-18(3,4)5/h12-15H,6-11H2,1-5H3,(H,19,21) |
| InChIKey | XRKNPPFRTSMZJQ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.55 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|