C20H38N2O3 — CID 21019257
tert-butyl 2-(octylcarbamoyl)azepane-1-carboxylate (PubChem CID 21019257) has the molecular formula C20H38N2O3 and a molecular weight of 354.54 g/mol. Its IUPAC name is tert-butyl 2-(octylcarbamoyl)azepane-1-carboxylate.
| Compound Name | tert-butyl 2-(octylcarbamoyl)azepane-1-carboxylate |
|---|---|
| PubChem CID | 21019257 |
| Molecular Formula | C20H38N2O3 |
| Molecular Weight | 354.54 g/mol |
| Exact Mass | 354.29 |
| IUPAC Name | tert-butyl 2-(octylcarbamoyl)azepane-1-carboxylate |
| SMILES | CCCCCCCCNC(=O)C1CCCCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H38N2O3/c1-5-6-7-8-9-12-15-21-18(23)17-14-11-10-13-16-22(17)19(24)25-20(2,3)4/h17H,5-16H2,1-4H3,(H,21,23) |
| InChIKey | JRBZJZGGEOYLPM-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.54 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|