C18H26N4O6S — CID 56544359
1-[2-[[3-(2-methoxyethylsulfamoyl)benzoyl]amino]acetyl]-N-methylpyrrolidine-2-carboxamide (PubChem CID 56544359) has the molecular formula C18H26N4O6S and a molecular weight of 426.50 g/mol. Its IUPAC name is 1-[2-[[3-(2-methoxyethylsulfamoyl)benzoyl]amino]acetyl]-N-methylpyrrolidine-2-carboxamide.
| Compound Name | 1-[2-[[3-(2-methoxyethylsulfamoyl)benzoyl]amino]acetyl]-N-methylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 56544359 |
| Molecular Formula | C18H26N4O6S |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | 1-[2-[[3-(2-methoxyethylsulfamoyl)benzoyl]amino]acetyl]-N-methylpyrrolidine-2-carboxamide |
| SMILES | CNC(=O)C1CCCN1C(=O)CNC(=O)c1cccc(S(=O)(=O)NCCOC)c1 |
| InChI | InChI=1S/C18H26N4O6S/c1-19-18(25)15-7-4-9-22(15)16(23)12-20-17(24)13-5-3-6-14(11-13)29(26,27)21-8-10-28-2/h3,5-6,11,15,21H,4,7-10,12H2,1-2H3,(H,19,25)(H,20,24) |
| InChIKey | HRZXAKRVXAEDQT-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|