C22H34N4O5S — CID 55565587
N-(2-methoxyethyl)-3-[4-[2-(2-methylpiperidin-1-yl)-2-oxoethyl]piperazine-1-carbonyl]benzenesulfonamide (PubChem CID 55565587) has the molecular formula C22H34N4O5S and a molecular weight of 466.60 g/mol. Its IUPAC name is N-(2-methoxyethyl)-3-[4-[2-(2-methylpiperidin-1-yl)-2-oxoethyl]piperazine-1-carbonyl]benzenesulfonamide.
| Compound Name | N-(2-methoxyethyl)-3-[4-[2-(2-methylpiperidin-1-yl)-2-oxoethyl]piperazine-1-carbonyl]benzenesulfonamide |
|---|---|
| PubChem CID | 55565587 |
| Molecular Formula | C22H34N4O5S |
| Molecular Weight | 466.60 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | N-(2-methoxyethyl)-3-[4-[2-(2-methylpiperidin-1-yl)-2-oxoethyl]piperazine-1-carbonyl]benzenesulfonamide |
| SMILES | COCCNS(=O)(=O)c1cccc(C(=O)N2CCN(CC(=O)N3CCCCC3C)CC2)c1 |
| InChI | InChI=1S/C22H34N4O5S/c1-18-6-3-4-10-26(18)21(27)17-24-11-13-25(14-12-24)22(28)19-7-5-8-20(16-19)32(29,30)23-9-15-31-2/h5,7-8,16,18,23H,3-4,6,9-15,17H2,1-2H3 |
| InChIKey | DFIDEWOGGVQYMI-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.60 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|