C16H25N3O6S2 — CID 39999775
3-(2-methoxyethylsulfamoyl)-N-(1-methylsulfonylpiperidin-4-yl)benzamide (PubChem CID 39999775) has the molecular formula C16H25N3O6S2 and a molecular weight of 419.53 g/mol. Its IUPAC name is 3-(2-methoxyethylsulfamoyl)-N-(1-methylsulfonylpiperidin-4-yl)benzamide.
| Compound Name | 3-(2-methoxyethylsulfamoyl)-N-(1-methylsulfonylpiperidin-4-yl)benzamide |
|---|---|
| PubChem CID | 39999775 |
| Molecular Formula | C16H25N3O6S2 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | 3-(2-methoxyethylsulfamoyl)-N-(1-methylsulfonylpiperidin-4-yl)benzamide |
| SMILES | COCCNS(=O)(=O)c1cccc(C(=O)NC2CCN(S(C)(=O)=O)CC2)c1 |
| InChI | InChI=1S/C16H25N3O6S2/c1-25-11-8-17-27(23,24)15-5-3-4-13(12-15)16(20)18-14-6-9-19(10-7-14)26(2,21)22/h3-5,12,14,17H,6-11H2,1-2H3,(H,18,20) |
| InChIKey | HMUIZGACMNJOGH-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|