C15H22N2O5S — CID 5017279
3,4-dimethoxy-N-(1-methylsulfonylpiperidin-4-yl)benzamide (PubChem CID 5017279) has the molecular formula C15H22N2O5S and a molecular weight of 342.42 g/mol. Its IUPAC name is 3,4-dimethoxy-N-(1-methylsulfonylpiperidin-4-yl)benzamide.
| Compound Name | 3,4-dimethoxy-N-(1-methylsulfonylpiperidin-4-yl)benzamide |
|---|---|
| PubChem CID | 5017279 |
| Molecular Formula | C15H22N2O5S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 3,4-dimethoxy-N-(1-methylsulfonylpiperidin-4-yl)benzamide |
| SMILES | COc1ccc(C(=O)NC2CCN(S(C)(=O)=O)CC2)cc1OC |
| InChI | InChI=1S/C15H22N2O5S/c1-21-13-5-4-11(10-14(13)22-2)15(18)16-12-6-8-17(9-7-12)23(3,19)20/h4-5,10,12H,6-9H2,1-3H3,(H,16,18) |
| InChIKey | CTTFETIOTZYAIW-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |