C15H20BrNO3 — CID 114309034
N-(4-bromocyclohexyl)-3,4-dimethoxybenzamide (PubChem CID 114309034) has the molecular formula C15H20BrNO3 and a molecular weight of 342.23 g/mol. Its IUPAC name is N-(4-bromocyclohexyl)-3,4-dimethoxybenzamide.
| Compound Name | N-(4-bromocyclohexyl)-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 114309034 |
| Molecular Formula | C15H20BrNO3 |
| Molecular Weight | 342.23 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | N-(4-bromocyclohexyl)-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NC2CCC(Br)CC2)cc1OC |
| InChI | InChI=1S/C15H20BrNO3/c1-19-13-8-3-10(9-14(13)20-2)15(18)17-12-6-4-11(16)5-7-12/h3,8-9,11-12H,4-7H2,1-2H3,(H,17,18) |
| InChIKey | LJFRUGKZHFJCHJ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.23 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|