C24H26N4O3 — CID 56544766
1-benzyl-N-[2-[2-(methylcarbamoyl)pyrrolidin-1-yl]-2-oxoethyl]indole-2-carboxamide (PubChem CID 56544766) has the molecular formula C24H26N4O3 and a molecular weight of 418.50 g/mol. Its IUPAC name is 1-benzyl-N-[2-[2-(methylcarbamoyl)pyrrolidin-1-yl]-2-oxoethyl]indole-2-carboxamide.
| Compound Name | 1-benzyl-N-[2-[2-(methylcarbamoyl)pyrrolidin-1-yl]-2-oxoethyl]indole-2-carboxamide |
|---|---|
| PubChem CID | 56544766 |
| Molecular Formula | C24H26N4O3 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | 1-benzyl-N-[2-[2-(methylcarbamoyl)pyrrolidin-1-yl]-2-oxoethyl]indole-2-carboxamide |
| SMILES | CNC(=O)C1CCCN1C(=O)CNC(=O)c1cc2ccccc2n1Cc1ccccc1 |
| InChI | InChI=1S/C24H26N4O3/c1-25-23(30)20-12-7-13-27(20)22(29)15-26-24(31)21-14-18-10-5-6-11-19(18)28(21)16-17-8-3-2-4-9-17/h2-6,8-11,14,20H,7,12-13,15-16H2,1H3,(H,25,30)(H,26,31) |
| InChIKey | QDNQBYWOZSLGKB-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 83.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |