C13H18BN3O4 — CID 15951641
[(2R)-1-[2-(phenylcarbamoylamino)acetyl]pyrrolidin-2-yl]boronic acid (PubChem CID 15951641) has the molecular formula C13H18BN3O4 and a molecular weight of 291.12 g/mol. Its IUPAC name is [(2R)-1-[2-(phenylcarbamoylamino)acetyl]pyrrolidin-2-yl]boronic acid.
| Compound Name | [(2R)-1-[2-(phenylcarbamoylamino)acetyl]pyrrolidin-2-yl]boronic acid |
|---|---|
| PubChem CID | 15951641 |
| Molecular Formula | C13H18BN3O4 |
| Molecular Weight | 291.12 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | [(2R)-1-[2-(phenylcarbamoylamino)acetyl]pyrrolidin-2-yl]boronic acid |
| SMILES | O=C(NCC(=O)N1CCC[C@H]1B(O)O)Nc1ccccc1 |
| InChI | InChI=1S/C13H18BN3O4/c18-12(17-8-4-7-11(17)14(20)21)9-15-13(19)16-10-5-2-1-3-6-10/h1-3,5-6,11,20-21H,4,7-9H2,(H2,15,16,19)/t11-/m0/s1 |
| InChIKey | HNIPCTASSCVURZ-NSHDSACASA-N |
| XLogP | -0.19 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.12 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|