C18H28N4O3 — CID 119728833
1-[[1-[2-(2-methoxyethylamino)acetyl]piperidin-2-yl]methyl]-3-phenylurea (PubChem CID 119728833) has the molecular formula C18H28N4O3 and a molecular weight of 348.45 g/mol. Its IUPAC name is 1-[[1-[2-(2-methoxyethylamino)acetyl]piperidin-2-yl]methyl]-3-phenylurea.
| Compound Name | 1-[[1-[2-(2-methoxyethylamino)acetyl]piperidin-2-yl]methyl]-3-phenylurea |
|---|---|
| PubChem CID | 119728833 |
| Molecular Formula | C18H28N4O3 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | 1-[[1-[2-(2-methoxyethylamino)acetyl]piperidin-2-yl]methyl]-3-phenylurea |
| SMILES | COCCNCC(=O)N1CCCCC1CNC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C18H28N4O3/c1-25-12-10-19-14-17(23)22-11-6-5-9-16(22)13-20-18(24)21-15-7-3-2-4-8-15/h2-4,7-8,16,19H,5-6,9-14H2,1H3,(H2,20,21,24) |
| InChIKey | CKQLRXCBPKFCQH-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|