C19H29ClN4O2 — CID 119728830
1-phenyl-3-[[1-(2-pyrrolidin-2-ylacetyl)piperidin-2-yl]methyl]urea;hydrochloride (PubChem CID 119728830) has the molecular formula C19H29ClN4O2 and a molecular weight of 380.92 g/mol. Its IUPAC name is 1-phenyl-3-[[1-(2-pyrrolidin-2-ylacetyl)piperidin-2-yl]methyl]urea;hydrochloride.
| Compound Name | 1-phenyl-3-[[1-(2-pyrrolidin-2-ylacetyl)piperidin-2-yl]methyl]urea;hydrochloride |
|---|---|
| PubChem CID | 119728830 |
| Molecular Formula | C19H29ClN4O2 |
| Molecular Weight | 380.92 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | 1-phenyl-3-[[1-(2-pyrrolidin-2-ylacetyl)piperidin-2-yl]methyl]urea;hydrochloride |
| SMILES | Cl.O=C(NCC1CCCCN1C(=O)CC1CCCN1)Nc1ccccc1 |
| InChI | InChI=1S/C19H28N4O2.ClH/c24-18(13-16-9-6-11-20-16)23-12-5-4-10-17(23)14-21-19(25)22-15-7-2-1-3-8-15;/h1-3,7-8,16-17,20H,4-6,9-14H2,(H2,21,22,25);1H |
| InChIKey | VFZAVLWTHKAUGH-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.92 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |