C12H16BN3O4 — CID 71655265
[(2R)-1-[2-(pyridine-4-carbonylamino)acetyl]pyrrolidin-2-yl]boronic acid (PubChem CID 71655265) has the molecular formula C12H16BN3O4 and a molecular weight of 277.09 g/mol. Its IUPAC name is [(2R)-1-[2-(pyridine-4-carbonylamino)acetyl]pyrrolidin-2-yl]boronic acid.
| Compound Name | [(2R)-1-[2-(pyridine-4-carbonylamino)acetyl]pyrrolidin-2-yl]boronic acid |
|---|---|
| PubChem CID | 71655265 |
| Molecular Formula | C12H16BN3O4 |
| Molecular Weight | 277.09 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | [(2R)-1-[2-(pyridine-4-carbonylamino)acetyl]pyrrolidin-2-yl]boronic acid |
| SMILES | O=C(NCC(=O)N1CCC[C@H]1B(O)O)c1ccncc1 |
| InChI | InChI=1S/C12H16BN3O4/c17-11(16-7-1-2-10(16)13(19)20)8-15-12(18)9-3-5-14-6-4-9/h3-6,10,19-20H,1-2,7-8H2,(H,15,18)/t10-/m0/s1 |
| InChIKey | NFLFYUMFQNNIPE-JTQLQIEISA-N |
| XLogP | -1.19 |
| TPSA | 102.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.09 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|