C13H16BFN2O5S — CID 178032780
[1-[2-[(4-fluorosulfinylbenzoyl)amino]acetyl]pyrrolidin-2-yl]boronic acid (PubChem CID 178032780) has the molecular formula C13H16BFN2O5S and a molecular weight of 342.16 g/mol. Its IUPAC name is [1-[2-[(4-fluorosulfinylbenzoyl)amino]acetyl]pyrrolidin-2-yl]boronic acid.
| Compound Name | [1-[2-[(4-fluorosulfinylbenzoyl)amino]acetyl]pyrrolidin-2-yl]boronic acid |
|---|---|
| PubChem CID | 178032780 |
| Molecular Formula | C13H16BFN2O5S |
| Molecular Weight | 342.16 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | [1-[2-[(4-fluorosulfinylbenzoyl)amino]acetyl]pyrrolidin-2-yl]boronic acid |
| SMILES | O=C(NCC(=O)N1CCCC1B(O)O)c1ccc(S(=O)F)cc1 |
| InChI | InChI=1S/C13H16BFN2O5S/c15-23(22)10-5-3-9(4-6-10)13(19)16-8-12(18)17-7-1-2-11(17)14(20)21/h3-6,11,20-21H,1-2,7-8H2,(H,16,19) |
| InChIKey | OUPGMJJAPAGRSE-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.16 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|