C12H23BN2O4 — CID 11402969
[(2S)-1-[2-[(4-hydroxycyclohexyl)amino]acetyl]pyrrolidin-2-yl]boronic acid (PubChem CID 11402969) has the molecular formula C12H23BN2O4 and a molecular weight of 270.14 g/mol. Its IUPAC name is [(2S)-1-[2-[(4-hydroxycyclohexyl)amino]acetyl]pyrrolidin-2-yl]boronic acid.
| Compound Name | [(2S)-1-[2-[(4-hydroxycyclohexyl)amino]acetyl]pyrrolidin-2-yl]boronic acid |
|---|---|
| PubChem CID | 11402969 |
| Molecular Formula | C12H23BN2O4 |
| Molecular Weight | 270.14 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | [(2S)-1-[2-[(4-hydroxycyclohexyl)amino]acetyl]pyrrolidin-2-yl]boronic acid |
| SMILES | O=C(CNC1CCC(O)CC1)N1CCC[C@@H]1B(O)O |
| InChI | InChI=1S/C12H23BN2O4/c16-10-5-3-9(4-6-10)14-8-12(17)15-7-1-2-11(15)13(18)19/h9-11,14,16,18-19H,1-8H2/t9?,10?,11-/m1/s1 |
| InChIKey | SSYIQAHTLAQLMC-VQXHTEKXSA-N |
| XLogP | -1.12 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.14 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|