C16H27BN2O4 — CID 166640371
[(2R)-1-[2-[(1-hydroxy-2-adamantyl)amino]acetyl]pyrrolidin-2-yl]boronic acid (PubChem CID 166640371) has the molecular formula C16H27BN2O4 and a molecular weight of 322.21 g/mol. Its IUPAC name is [(2R)-1-[2-[(1-hydroxy-2-adamantyl)amino]acetyl]pyrrolidin-2-yl]boronic acid.
| Compound Name | [(2R)-1-[2-[(1-hydroxy-2-adamantyl)amino]acetyl]pyrrolidin-2-yl]boronic acid |
|---|---|
| PubChem CID | 166640371 |
| Molecular Formula | C16H27BN2O4 |
| Molecular Weight | 322.21 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | [(2R)-1-[2-[(1-hydroxy-2-adamantyl)amino]acetyl]pyrrolidin-2-yl]boronic acid |
| SMILES | O=C(CNC1C2CC3CC(C2)CC1(O)C3)N1CCC[C@H]1B(O)O |
| InChI | InChI=1S/C16H27BN2O4/c20-14(19-3-1-2-13(19)17(22)23)9-18-15-12-5-10-4-11(6-12)8-16(15,21)7-10/h10-13,15,18,21-23H,1-9H2/t10?,11?,12?,13-,15?,16?/m0/s1 |
| InChIKey | SSTRPLHEPRPJKM-CWMIJDORSA-N |
| XLogP | -0.48 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.21 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|