C16H27BN2O3 — CID 15951544
[(2R)-1-[2-(2-adamantylamino)acetyl]pyrrolidin-2-yl]boronic acid (PubChem CID 15951544) has the molecular formula C16H27BN2O3 and a molecular weight of 306.22 g/mol. Its IUPAC name is [(2R)-1-[2-(2-adamantylamino)acetyl]pyrrolidin-2-yl]boronic acid.
| Compound Name | [(2R)-1-[2-(2-adamantylamino)acetyl]pyrrolidin-2-yl]boronic acid |
|---|---|
| PubChem CID | 15951544 |
| Molecular Formula | C16H27BN2O3 |
| Molecular Weight | 306.22 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | [(2R)-1-[2-(2-adamantylamino)acetyl]pyrrolidin-2-yl]boronic acid |
| SMILES | O=C(CNC1C2CC3CC(C2)CC1C3)N1CCC[C@H]1B(O)O |
| InChI | InChI=1S/C16H27BN2O3/c20-15(19-3-1-2-14(19)17(21)22)9-18-16-12-5-10-4-11(7-12)8-13(16)6-10/h10-14,16,18,21-22H,1-9H2/t10?,11?,12?,13?,14-,16?/m0/s1 |
| InChIKey | BZOKGOVFXOVEJF-NUAPRZDKSA-N |
| XLogP | 0.40 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.22 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|