C10H22BN3O3+2 — CID 59624138
[2-[(2R)-2-boronopyrrolidin-1-yl]-2-oxoethyl]-[(3R)-pyrrolidin-1-ium-3-yl]azanium (PubChem CID 59624138) has the molecular formula C10H22BN3O3+2 and a molecular weight of 243.12 g/mol. Its IUPAC name is [2-[(2R)-2-boronopyrrolidin-1-yl]-2-oxoethyl]-[(3R)-pyrrolidin-1-ium-3-yl]azanium.
| Compound Name | [2-[(2R)-2-boronopyrrolidin-1-yl]-2-oxoethyl]-[(3R)-pyrrolidin-1-ium-3-yl]azanium |
|---|---|
| PubChem CID | 59624138 |
| Molecular Formula | C10H22BN3O3+2 |
| Molecular Weight | 243.12 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | [2-[(2R)-2-boronopyrrolidin-1-yl]-2-oxoethyl]-[(3R)-pyrrolidin-1-ium-3-yl]azanium |
| SMILES | O=C(C[NH2+][C@@H]1CC[NH2+]C1)N1CCC[C@H]1B(O)O |
| InChI | InChI=1S/C10H20BN3O3/c15-10(7-13-8-3-4-12-6-8)14-5-1-2-9(14)11(16)17/h8-9,12-13,16-17H,1-7H2/p+2/t8-,9+/m1/s1 |
| InChIKey | DVJAMEIQRSHVKC-BDAKNGLRSA-P |
| XLogP | -4.11 |
| TPSA | 93.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.12 |
| LogP ≤ 5 | -4.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|